C22H24FNO5S — CID 102571023
tert-butyl N-[2-(3-fluorophenyl)-1-formyl-3-(4-methylphenyl)sulfonylcyclopropyl]carbamate (PubChem CID 102571023) has the molecular formula C22H24FNO5S and a molecular weight of 433.50 g/mol. Its IUPAC name is tert-butyl N-[2-(3-fluorophenyl)-1-formyl-3-(4-methylphenyl)sulfonylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-fluorophenyl)-1-formyl-3-(4-methylphenyl)sulfonylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 102571023 |
| Molecular Formula | C22H24FNO5S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | tert-butyl N-[2-(3-fluorophenyl)-1-formyl-3-(4-methylphenyl)sulfonylcyclopropyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)C2C(c3cccc(F)c3)C2(C=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H24FNO5S/c1-14-8-10-17(11-9-14)30(27,28)19-18(15-6-5-7-16(23)12-15)22(19,13-25)24-20(26)29-21(2,3)4/h5-13,18-19H,1-4H3,(H,24,26) |
| InChIKey | DFBZIDNPIPZLGT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|