C22H25NO5S — CID 129412871
tert-butyl N-[(1S,2S,3R)-1-formyl-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropyl]carbamate (PubChem CID 129412871) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,3R)-1-formyl-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,3R)-1-formyl-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 129412871 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | tert-butyl N-[(1S,2S,3R)-1-formyl-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2[C@H](c3ccccc3)[C@@]2(C=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H25NO5S/c1-15-10-12-17(13-11-15)29(26,27)19-18(16-8-6-5-7-9-16)22(19,14-24)23-20(25)28-21(2,3)4/h5-14,18-19H,1-4H3,(H,23,25)/t18-,19-,22+/m0/s1 |
| InChIKey | VHOKFUOHKAMLTC-CNNODRBYSA-N |
| XLogP | 3.40 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|