C17H22ClNO5S — CID 129413132
tert-butyl N-[(1S,2S,3S)-2-(3-chlorophenyl)-3-ethylsulfonyl-1-formylcyclopropyl]carbamate (PubChem CID 129413132) has the molecular formula C17H22ClNO5S and a molecular weight of 387.89 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,3S)-2-(3-chlorophenyl)-3-ethylsulfonyl-1-formylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,3S)-2-(3-chlorophenyl)-3-ethylsulfonyl-1-formylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 129413132 |
| Molecular Formula | C17H22ClNO5S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | tert-butyl N-[(1S,2S,3S)-2-(3-chlorophenyl)-3-ethylsulfonyl-1-formylcyclopropyl]carbamate |
| SMILES | CCS(=O)(=O)[C@H]1[C@@H](c2cccc(Cl)c2)[C@@]1(C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22ClNO5S/c1-5-25(22,23)14-13(11-7-6-8-12(18)9-11)17(14,10-20)19-15(21)24-16(2,3)4/h6-10,13-14H,5H2,1-4H3,(H,19,21)/t13-,14+,17-/m1/s1 |
| InChIKey | BQXMCPXMFHMVIY-JKIFEVAISA-N |
| XLogP | 2.70 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|