C19H27NO5S — CID 129413143
tert-butyl N-[(1R,2R,3R)-2-(4-ethylphenyl)-3-ethylsulfonyl-1-formylcyclopropyl]carbamate (PubChem CID 129413143) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,3R)-2-(4-ethylphenyl)-3-ethylsulfonyl-1-formylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,3R)-2-(4-ethylphenyl)-3-ethylsulfonyl-1-formylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 129413143 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | tert-butyl N-[(1R,2R,3R)-2-(4-ethylphenyl)-3-ethylsulfonyl-1-formylcyclopropyl]carbamate |
| SMILES | CCc1ccc([C@H]2[C@@H](S(=O)(=O)CC)[C@@]2(C=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H27NO5S/c1-6-13-8-10-14(11-9-13)15-16(26(23,24)7-2)19(15,12-21)20-17(22)25-18(3,4)5/h8-12,15-16H,6-7H2,1-5H3,(H,20,22)/t15-,16+,19-/m0/s1 |
| InChIKey | CUDZMCHMQZJDDB-FCEWJHQRSA-N |
| XLogP | 2.61 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|