C19H23NO7S — CID 89158731
6-(4-methylphenyl)sulfonyloxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 89158731) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfonyloxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-(4-methylphenyl)sulfonyloxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 89158731 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 6-(4-methylphenyl)sulfonyloxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC2(NC(=O)OC(C)(C)C)C=CC=CC2C(=O)O)cc1 |
| InChI | InChI=1S/C19H23NO7S/c1-13-8-10-14(11-9-13)28(24,25)27-19(20-17(23)26-18(2,3)4)12-6-5-7-15(19)16(21)22/h5-12,15H,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | VGFSGSNSAQVXCL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|