C17H23NO7S — CID 101036897
methyl (Z)-3-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate (PubChem CID 101036897) has the molecular formula C17H23NO7S and a molecular weight of 385.44 g/mol. Its IUPAC name is methyl (Z)-3-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate.
| Compound Name | methyl (Z)-3-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate |
|---|---|
| PubChem CID | 101036897 |
| Molecular Formula | C17H23NO7S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | methyl (Z)-3-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate |
| SMILES | COC(=O)/C(NC(=O)OC(C)(C)C)=C(\C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO7S/c1-11-7-9-13(10-8-11)26(21,22)25-12(2)14(15(19)23-6)18-16(20)24-17(3,4)5/h7-10H,1-6H3,(H,18,20)/b14-12- |
| InChIKey | PEKISJRRXDEPQX-OWBHPGMISA-N |
| XLogP | 2.63 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|