C16H25N3O4S — CID 101154955
tert-butyl N-[N-(4-methylphenyl)sulfonyl-N'-propylcarbamimidoyl]carbamate (PubChem CID 101154955) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is tert-butyl N-[N-(4-methylphenyl)sulfonyl-N'-propylcarbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-(4-methylphenyl)sulfonyl-N'-propylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 101154955 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | tert-butyl N-[N-(4-methylphenyl)sulfonyl-N'-propylcarbamimidoyl]carbamate |
| SMILES | CCC/N=C(\NC(=O)OC(C)(C)C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H25N3O4S/c1-6-11-17-14(18-15(20)23-16(3,4)5)19-24(21,22)13-9-7-12(2)8-10-13/h7-10H,6,11H2,1-5H3,(H2,17,18,19,20) |
| InChIKey | UZNPVAYCWUMOEQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|