C32H31Cl2N3O5S — CID 142418414
tert-butyl N-[N-(benzenesulfonyl)-N'-[[4,5-bis(4-chlorophenyl)-2-methoxyphenyl]methyl]carbamimidoyl]carbamate (PubChem CID 142418414) has the molecular formula C32H31Cl2N3O5S and a molecular weight of 640.59 g/mol. Its IUPAC name is tert-butyl N-[N-(benzenesulfonyl)-N'-[[4,5-bis(4-chlorophenyl)-2-methoxyphenyl]methyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-(benzenesulfonyl)-N'-[[4,5-bis(4-chlorophenyl)-2-methoxyphenyl]methyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 142418414 |
| Molecular Formula | C32H31Cl2N3O5S |
| Molecular Weight | 640.59 g/mol |
| Exact Mass | 639.14 |
| IUPAC Name | tert-butyl N-[N-(benzenesulfonyl)-N'-[[4,5-bis(4-chlorophenyl)-2-methoxyphenyl]methyl]carbamimidoyl]carbamate |
| SMILES | COc1cc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)cc1C/N=C(\NC(=O)OC(C)(C)C)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H31Cl2N3O5S/c1-32(2,3)42-31(38)36-30(37-43(39,40)26-8-6-5-7-9-26)35-20-23-18-27(21-10-14-24(33)15-11-21)28(19-29(23)41-4)22-12-16-25(34)17-13-22/h5-19H,20H2,1-4H3,(H2,35,36,37,38) |
| InChIKey | JTOGCOGGMDYOCI-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.59 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|