C30H28Cl2N4O4S — CID 134227798
tert-butyl N-[N-(benzenesulfonyl)-N'-[[6-(3-chlorophenyl)-5-(4-chlorophenyl)-3-pyridinyl]methyl]carbamimidoyl]carbamate (PubChem CID 134227798) has the molecular formula C30H28Cl2N4O4S and a molecular weight of 611.55 g/mol. Its IUPAC name is tert-butyl N-[N-(benzenesulfonyl)-N'-[[6-(3-chlorophenyl)-5-(4-chlorophenyl)-3-pyridinyl]methyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-(benzenesulfonyl)-N'-[[6-(3-chlorophenyl)-5-(4-chlorophenyl)-3-pyridinyl]methyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 134227798 |
| Molecular Formula | C30H28Cl2N4O4S |
| Molecular Weight | 611.55 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | tert-butyl N-[N-(benzenesulfonyl)-N'-[[6-(3-chlorophenyl)-5-(4-chlorophenyl)-3-pyridinyl]methyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=N\Cc1cnc(-c2cccc(Cl)c2)c(-c2ccc(Cl)cc2)c1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H28Cl2N4O4S/c1-30(2,3)40-29(37)35-28(36-41(38,39)25-10-5-4-6-11-25)34-19-20-16-26(21-12-14-23(31)15-13-21)27(33-18-20)22-8-7-9-24(32)17-22/h4-18H,19H2,1-3H3,(H2,34,35,36,37) |
| InChIKey | CDHGRKOXWMDANJ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|