C29H30N4O3S — CID 163472176
1-(benzenesulfonyl)-2-[[6-(4-methylphenyl)-5-(4-propan-2-yloxyphenyl)-3-pyridinyl]methyl]guanidine (PubChem CID 163472176) has the molecular formula C29H30N4O3S and a molecular weight of 514.65 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-[[6-(4-methylphenyl)-5-(4-propan-2-yloxyphenyl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(benzenesulfonyl)-2-[[6-(4-methylphenyl)-5-(4-propan-2-yloxyphenyl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 163472176 |
| Molecular Formula | C29H30N4O3S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 1-(benzenesulfonyl)-2-[[6-(4-methylphenyl)-5-(4-propan-2-yloxyphenyl)-3-pyridinyl]methyl]guanidine |
| SMILES | Cc1ccc(-c2ncc(C/N=C(\N)NS(=O)(=O)c3ccccc3)cc2-c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H30N4O3S/c1-20(2)36-25-15-13-23(14-16-25)27-17-22(18-31-28(27)24-11-9-21(3)10-12-24)19-32-29(30)33-37(34,35)26-7-5-4-6-8-26/h4-18,20H,19H2,1-3H3,(H3,30,32,33) |
| InChIKey | BXKSBLTZWQDQKF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|