C25H21ClN4O3S — CID 137313426
1-(benzenesulfonyl)-2-[[5-(4-chlorophenyl)-6-(4-hydroxyphenyl)-3-pyridinyl]methyl]guanidine (PubChem CID 137313426) has the molecular formula C25H21ClN4O3S and a molecular weight of 492.99 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-[[5-(4-chlorophenyl)-6-(4-hydroxyphenyl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(benzenesulfonyl)-2-[[5-(4-chlorophenyl)-6-(4-hydroxyphenyl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 137313426 |
| Molecular Formula | C25H21ClN4O3S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 1-(benzenesulfonyl)-2-[[5-(4-chlorophenyl)-6-(4-hydroxyphenyl)-3-pyridinyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1cnc(-c2ccc(O)cc2)c(-c2ccc(Cl)cc2)c1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H21ClN4O3S/c26-20-10-6-18(7-11-20)23-14-17(15-28-24(23)19-8-12-21(31)13-9-19)16-29-25(27)30-34(32,33)22-4-2-1-3-5-22/h1-15,31H,16H2,(H3,27,29,30) |
| InChIKey | APZZOGGCXWVNDW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|