C25H20Cl2N4O3S — CID 138677887
1-(benzenesulfonamido)-1-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]urea (PubChem CID 138677887) has the molecular formula C25H20Cl2N4O3S and a molecular weight of 527.43 g/mol. Its IUPAC name is 1-(benzenesulfonamido)-1-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]urea.
| Compound Name | 1-(benzenesulfonamido)-1-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 138677887 |
| Molecular Formula | C25H20Cl2N4O3S |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 1-(benzenesulfonamido)-1-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]urea |
| SMILES | NC(=O)N(Cc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20Cl2N4O3S/c26-20-10-6-18(7-11-20)23-14-17(15-29-24(23)19-8-12-21(27)13-9-19)16-31(25(28)32)30-35(33,34)22-4-2-1-3-5-22/h1-15,30H,16H2,(H2,28,32) |
| InChIKey | RNVTUFJCZZDHDX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|