C25H19Cl2FN4O2S — CID 134227830
2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(4-fluorophenyl)sulfonylguanidine (PubChem CID 134227830) has the molecular formula C25H19Cl2FN4O2S and a molecular weight of 529.42 g/mol. Its IUPAC name is 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(4-fluorophenyl)sulfonylguanidine.
| Compound Name | 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(4-fluorophenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 134227830 |
| Molecular Formula | C25H19Cl2FN4O2S |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(4-fluorophenyl)sulfonylguanidine |
| SMILES | N/C(=N\Cc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c1)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H19Cl2FN4O2S/c26-19-5-1-17(2-6-19)23-13-16(14-30-24(23)18-3-7-20(27)8-4-18)15-31-25(29)32-35(33,34)22-11-9-21(28)10-12-22/h1-14H,15H2,(H3,29,31,32) |
| InChIKey | QXVYKYZPEJVZDA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|