C18H12ClF2N — CID 131870202
5-(chloromethyl)-2,3-bis(4-fluorophenyl)pyridine (PubChem CID 131870202) has the molecular formula C18H12ClF2N and a molecular weight of 315.75 g/mol. Its IUPAC name is 5-(chloromethyl)-2,3-bis(4-fluorophenyl)pyridine.
| Compound Name | 5-(chloromethyl)-2,3-bis(4-fluorophenyl)pyridine |
|---|---|
| PubChem CID | 131870202 |
| Molecular Formula | C18H12ClF2N |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 5-(chloromethyl)-2,3-bis(4-fluorophenyl)pyridine |
| SMILES | Fc1ccc(-c2cc(CCl)cnc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H12ClF2N/c19-10-12-9-17(13-1-5-15(20)6-2-13)18(22-11-12)14-3-7-16(21)8-4-14/h1-9,11H,10H2 |
| InChIKey | ZNHKPDNTKHWEKA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|