C12H8ClF2N — CID 165454838
3-(chloromethyl)-5-(2,4-difluorophenyl)pyridine (PubChem CID 165454838) has the molecular formula C12H8ClF2N and a molecular weight of 239.65 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(2,4-difluorophenyl)pyridine.
| Compound Name | 3-(chloromethyl)-5-(2,4-difluorophenyl)pyridine |
|---|---|
| PubChem CID | 165454838 |
| Molecular Formula | C12H8ClF2N |
| Molecular Weight | 239.65 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 3-(chloromethyl)-5-(2,4-difluorophenyl)pyridine |
| SMILES | Fc1ccc(-c2cncc(CCl)c2)c(F)c1 |
| InChI | InChI=1S/C12H8ClF2N/c13-5-8-3-9(7-16-6-8)11-2-1-10(14)4-12(11)15/h1-4,6-7H,5H2 |
| InChIKey | GJGMUOWTYQIVIK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|