C23H20ClF2N3O — CID 10159593
N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride (PubChem CID 10159593) has the molecular formula C23H20ClF2N3O and a molecular weight of 427.88 g/mol. Its IUPAC name is N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride.
| Compound Name | N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride |
|---|---|
| PubChem CID | 10159593 |
| Molecular Formula | C23H20ClF2N3O |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride |
| SMILES | Cl.Fc1ccc(-c2cncc(CNCCOc3cccc4cccnc34)c2)c(F)c1 |
| InChI | InChI=1S/C23H19F2N3O.ClH/c24-19-6-7-20(21(25)12-19)18-11-16(14-27-15-18)13-26-9-10-29-22-5-1-3-17-4-2-8-28-23(17)22;/h1-8,11-12,14-15,26H,9-10,13H2;1H |
| InChIKey | AZSQUJOBFLIBTR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|