About N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride
N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride (PubChem CID 10159593) has the molecular formula C23H20ClF2N3O
and a molecular weight of 427.88 g/mol. Its IUPAC name is N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride.
Molecular Properties
| Compound Name | N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride |
| PubChem CID | 10159593 |
| Molecular Formula | C23H20ClF2N3O |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride |
| SMILES | Cl.Fc1ccc(-c2cncc(CNCCOc3cccc4cccnc34)c2)c(F)c1 |
| InChI | InChI=1S/C23H19F2N3O.ClH/c24-19-6-7-20(21(25)12-19)18-11-16(14-27-15-18)13-26-9-10-29-22-5-1-3-17-4-2-8-28-23(17)22;/h1-8,11-12,14-15,26H,9-10,13H2;1H |
| InChIKey | AZSQUJOBFLIBTR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride?
The IUPAC name of N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride (CID 10159593) is N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride.
What is the SMILES notation for N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride?
The canonical SMILES for N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride is Cl.Fc1ccc(-c2cncc(CNCCOc3cccc4cccnc34)c2)c(F)c1.
What is the InChIKey of N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride?
The InChIKey is AZSQUJOBFLIBTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F2N3O.ClH/c24-19-6-7-20(21(25)12-19)18-11-16(14-27-15-18)13-26-9-10-29-22-5-1-3-17-4-2-8-28-23(17)22;/h1-8,11-12,14-15,26H,9-10,13H2;1H.
What are the key properties of N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride?
N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride has a molecular weight of 427.88 g/mol, XLogP of 5.17, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-quinolin-8-yloxyethanamine;hydrochloride is sourced from PubChem (CID 10159593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).