C25H24FN3O3 — CID 10207532
ethyl 7-[2-[[5-(3-fluorophenyl)-3-pyridinyl]methylamino]ethoxy]-1H-indole-2-carboxylate (PubChem CID 10207532) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is ethyl 7-[2-[[5-(3-fluorophenyl)-3-pyridinyl]methylamino]ethoxy]-1H-indole-2-carboxylate.
| Compound Name | ethyl 7-[2-[[5-(3-fluorophenyl)-3-pyridinyl]methylamino]ethoxy]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 10207532 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | ethyl 7-[2-[[5-(3-fluorophenyl)-3-pyridinyl]methylamino]ethoxy]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cccc(OCCNCc3cncc(-c4cccc(F)c4)c3)c2[nH]1 |
| InChI | InChI=1S/C25H24FN3O3/c1-2-31-25(30)22-13-19-6-4-8-23(24(19)29-22)32-10-9-27-14-17-11-20(16-28-15-17)18-5-3-7-21(26)12-18/h3-8,11-13,15-16,27,29H,2,9-10,14H2,1H3 |
| InChIKey | UOFXRRBFRITIEA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|