C26H20ClF3N4O3S — CID 134228127
1-(benzenesulfonyl)-2-[[6-(4-chlorophenyl)-5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]methyl]guanidine (PubChem CID 134228127) has the molecular formula C26H20ClF3N4O3S and a molecular weight of 560.99 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-[[6-(4-chlorophenyl)-5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(benzenesulfonyl)-2-[[6-(4-chlorophenyl)-5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 134228127 |
| Molecular Formula | C26H20ClF3N4O3S |
| Molecular Weight | 560.99 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | 1-(benzenesulfonyl)-2-[[6-(4-chlorophenyl)-5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(OC(F)(F)F)cc2)c1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H20ClF3N4O3S/c27-20-10-6-19(7-11-20)24-23(18-8-12-21(13-9-18)37-26(28,29)30)14-17(15-32-24)16-33-25(31)34-38(35,36)22-4-2-1-3-5-22/h1-15H,16H2,(H3,31,33,34) |
| InChIKey | NRHZBTJYKFYCAD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|