C21H19FIN3O3S — CID 142418383
1-(benzenesulfonyl)-2-[[3-fluoro-4-iodo-5-(4-methoxyphenyl)phenyl]methyl]guanidine (PubChem CID 142418383) has the molecular formula C21H19FIN3O3S and a molecular weight of 539.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-[[3-fluoro-4-iodo-5-(4-methoxyphenyl)phenyl]methyl]guanidine.
| Compound Name | 1-(benzenesulfonyl)-2-[[3-fluoro-4-iodo-5-(4-methoxyphenyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 142418383 |
| Molecular Formula | C21H19FIN3O3S |
| Molecular Weight | 539.37 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | 1-(benzenesulfonyl)-2-[[3-fluoro-4-iodo-5-(4-methoxyphenyl)phenyl]methyl]guanidine |
| SMILES | COc1ccc(-c2cc(C/N=C(\N)NS(=O)(=O)c3ccccc3)cc(F)c2I)cc1 |
| InChI | InChI=1S/C21H19FIN3O3S/c1-29-16-9-7-15(8-10-16)18-11-14(12-19(22)20(18)23)13-25-21(24)26-30(27,28)17-5-3-2-4-6-17/h2-12H,13H2,1H3,(H3,24,25,26) |
| InChIKey | DMNCKMGTKSSKDY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|