C25H22ClN3O3S2 — CID 142418362
2-[[4-(4-chlorophenyl)-3-(4-methoxyphenyl)phenyl]methyl]-1-thiophen-2-ylsulfonylguanidine (PubChem CID 142418362) has the molecular formula C25H22ClN3O3S2 and a molecular weight of 512.06 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-3-(4-methoxyphenyl)phenyl]methyl]-1-thiophen-2-ylsulfonylguanidine.
| Compound Name | 2-[[4-(4-chlorophenyl)-3-(4-methoxyphenyl)phenyl]methyl]-1-thiophen-2-ylsulfonylguanidine |
|---|---|
| PubChem CID | 142418362 |
| Molecular Formula | C25H22ClN3O3S2 |
| Molecular Weight | 512.06 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-3-(4-methoxyphenyl)phenyl]methyl]-1-thiophen-2-ylsulfonylguanidine |
| SMILES | COc1ccc(-c2cc(C/N=C(\N)NS(=O)(=O)c3cccs3)ccc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H22ClN3O3S2/c1-32-21-11-7-19(8-12-21)23-15-17(4-13-22(23)18-5-9-20(26)10-6-18)16-28-25(27)29-34(30,31)24-3-2-14-33-24/h2-15H,16H2,1H3,(H3,27,28,29) |
| InChIKey | KIEYMMYVIJGNFG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.06 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|