C14H12N2O4S2 — CID 110402463
N-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]thiophene-2-sulfonamide (PubChem CID 110402463) has the molecular formula C14H12N2O4S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]thiophene-2-sulfonamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110402463 |
| Molecular Formula | C14H12N2O4S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(-c2cnoc2NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H12N2O4S2/c1-19-11-6-4-10(5-7-11)12-9-15-20-14(12)16-22(17,18)13-3-2-8-21-13/h2-9,16H,1H3 |
| InChIKey | IDMONSHLBGUYGV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |