C13H9ClN2O3S2 — CID 110402158
5-chloro-N-(4-phenyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide (PubChem CID 110402158) has the molecular formula C13H9ClN2O3S2 and a molecular weight of 340.81 g/mol. Its IUPAC name is 5-chloro-N-(4-phenyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(4-phenyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110402158 |
| Molecular Formula | C13H9ClN2O3S2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 5-chloro-N-(4-phenyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1oncc1-c1ccccc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H9ClN2O3S2/c14-11-6-7-12(20-11)21(17,18)16-13-10(8-15-19-13)9-4-2-1-3-5-9/h1-8,16H |
| InChIKey | QVCNXDXGLVJECD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |