C8H6ClN3O2S2 — CID 19683573
5-chloro-N-pyrimidin-2-ylthiophene-2-sulfonamide (PubChem CID 19683573) has the molecular formula C8H6ClN3O2S2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 5-chloro-N-pyrimidin-2-ylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-pyrimidin-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 19683573 |
| Molecular Formula | C8H6ClN3O2S2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 5-chloro-N-pyrimidin-2-ylthiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ncccn1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H6ClN3O2S2/c9-6-2-3-7(15-6)16(13,14)12-8-10-4-1-5-11-8/h1-5H,(H,10,11,12) |
| InChIKey | NEAPHIOTTOTVJH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |