C11H8ClN3O2S2 — CID 110734785
5-chloro-N-imidazo[1,2-a]pyridin-6-ylthiophene-2-sulfonamide (PubChem CID 110734785) has the molecular formula C11H8ClN3O2S2 and a molecular weight of 313.79 g/mol. Its IUPAC name is 5-chloro-N-imidazo[1,2-a]pyridin-6-ylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-imidazo[1,2-a]pyridin-6-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110734785 |
| Molecular Formula | C11H8ClN3O2S2 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 5-chloro-N-imidazo[1,2-a]pyridin-6-ylthiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2nccn2c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H8ClN3O2S2/c12-9-2-4-11(18-9)19(16,17)14-8-1-3-10-13-5-6-15(10)7-8/h1-7,14H |
| InChIKey | PNPJNTAKDQUDFW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |