C13H10ClN3O2S — CID 110734813
3-chloro-N-imidazo[1,2-a]pyridin-6-ylbenzenesulfonamide (PubChem CID 110734813) has the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. Its IUPAC name is 3-chloro-N-imidazo[1,2-a]pyridin-6-ylbenzenesulfonamide.
| Compound Name | 3-chloro-N-imidazo[1,2-a]pyridin-6-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 110734813 |
| Molecular Formula | C13H10ClN3O2S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 3-chloro-N-imidazo[1,2-a]pyridin-6-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2nccn2c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H10ClN3O2S/c14-10-2-1-3-12(8-10)20(18,19)16-11-4-5-13-15-6-7-17(13)9-11/h1-9,16H |
| InChIKey | IYYKJEGSQFZJEY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |