C21H17ClN4O3S — CID 56928346
4-[(3-chlorophenyl)sulfamoyl]-N-(imidazo[1,2-a]pyridin-6-ylmethyl)benzamide (PubChem CID 56928346) has the molecular formula C21H17ClN4O3S and a molecular weight of 440.91 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)sulfamoyl]-N-(imidazo[1,2-a]pyridin-6-ylmethyl)benzamide.
| Compound Name | 4-[(3-chlorophenyl)sulfamoyl]-N-(imidazo[1,2-a]pyridin-6-ylmethyl)benzamide |
|---|---|
| PubChem CID | 56928346 |
| Molecular Formula | C21H17ClN4O3S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 4-[(3-chlorophenyl)sulfamoyl]-N-(imidazo[1,2-a]pyridin-6-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccc2nccn2c1)c1ccc(S(=O)(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H17ClN4O3S/c22-17-2-1-3-18(12-17)25-30(28,29)19-7-5-16(6-8-19)21(27)24-13-15-4-9-20-23-10-11-26(20)14-15/h1-12,14,25H,13H2,(H,24,27) |
| InChIKey | PIHCZXLOXXEVBD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |