C19H17ClN4O3S — CID 135222969
1-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 135222969) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is 1-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135222969 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 1-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(S(=O)(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H17ClN4O3S/c20-15-2-1-3-17(12-15)24-28(26,27)18-6-4-16(5-7-18)23-19(25)22-13-14-8-10-21-11-9-14/h1-12,24H,13H2,(H2,22,23,25) |
| InChIKey | HKOSJCKCFOHZGG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |