C19H16IN3O3S — CID 135222928
1-[4-(3-iodophenyl)sulfonylphenyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 135222928) has the molecular formula C19H16IN3O3S and a molecular weight of 493.33 g/mol. Its IUPAC name is 1-[4-(3-iodophenyl)sulfonylphenyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[4-(3-iodophenyl)sulfonylphenyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135222928 |
| Molecular Formula | C19H16IN3O3S |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | 1-[4-(3-iodophenyl)sulfonylphenyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(S(=O)(=O)c2cccc(I)c2)cc1 |
| InChI | InChI=1S/C19H16IN3O3S/c20-15-2-1-3-18(12-15)27(25,26)17-6-4-16(5-7-17)23-19(24)22-13-14-8-10-21-11-9-14/h1-12H,13H2,(H2,22,23,24) |
| InChIKey | JAYTUFQVFKIEFV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|