C18H13ClF2N2O2S — CID 112990324
3-chloro-N-[4-(3,4-difluoroanilino)phenyl]benzenesulfonamide (PubChem CID 112990324) has the molecular formula C18H13ClF2N2O2S and a molecular weight of 394.83 g/mol. Its IUPAC name is 3-chloro-N-[4-(3,4-difluoroanilino)phenyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[4-(3,4-difluoroanilino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112990324 |
| Molecular Formula | C18H13ClF2N2O2S |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 3-chloro-N-[4-(3,4-difluoroanilino)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2ccc(F)c(F)c2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13ClF2N2O2S/c19-12-2-1-3-16(10-12)26(24,25)23-14-6-4-13(5-7-14)22-15-8-9-17(20)18(21)11-15/h1-11,22-23H |
| InChIKey | PTCUYLGRSTXBHT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |