C9H8ClN3O2S2 — CID 55025745
N-(6-amino-3-pyridinyl)-5-chlorothiophene-2-sulfonamide (PubChem CID 55025745) has the molecular formula C9H8ClN3O2S2 and a molecular weight of 289.77 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-(6-amino-3-pyridinyl)-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55025745 |
| Molecular Formula | C9H8ClN3O2S2 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-5-chlorothiophene-2-sulfonamide |
| SMILES | Nc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C9H8ClN3O2S2/c10-7-2-4-9(16-7)17(14,15)13-6-1-3-8(11)12-5-6/h1-5,13H,(H2,11,12) |
| InChIKey | NZDBZYGQQLLWOO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |