C16H11ClN4O2S2 — CID 113022728
5-chloro-N-[6-(2-cyanoanilino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113022728) has the molecular formula C16H11ClN4O2S2 and a molecular weight of 390.88 g/mol. Its IUPAC name is 5-chloro-N-[6-(2-cyanoanilino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[6-(2-cyanoanilino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113022728 |
| Molecular Formula | C16H11ClN4O2S2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 5-chloro-N-[6-(2-cyanoanilino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | N#Cc1ccccc1Nc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C16H11ClN4O2S2/c17-14-6-8-16(24-14)25(22,23)21-12-5-7-15(19-10-12)20-13-4-2-1-3-11(13)9-18/h1-8,10,21H,(H,19,20) |
| InChIKey | XBDYILQBCIQBJP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |