C12H14ClN3O3S2 — CID 113010420
5-chloro-N-[6-(2-methoxyethylamino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113010420) has the molecular formula C12H14ClN3O3S2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 5-chloro-N-[6-(2-methoxyethylamino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[6-(2-methoxyethylamino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113010420 |
| Molecular Formula | C12H14ClN3O3S2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 5-chloro-N-[6-(2-methoxyethylamino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | COCCNc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C12H14ClN3O3S2/c1-19-7-6-14-11-4-2-9(8-15-11)16-21(17,18)12-5-3-10(13)20-12/h2-5,8,16H,6-7H2,1H3,(H,14,15) |
| InChIKey | UWHHWZPHLIDSHJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|