C15H11ClN2O2S2 — CID 110634676
5-chloro-N-(5-phenyl-2-pyridinyl)thiophene-2-sulfonamide (PubChem CID 110634676) has the molecular formula C15H11ClN2O2S2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 5-chloro-N-(5-phenyl-2-pyridinyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(5-phenyl-2-pyridinyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110634676 |
| Molecular Formula | C15H11ClN2O2S2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 5-chloro-N-(5-phenyl-2-pyridinyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2ccccc2)cn1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H11ClN2O2S2/c16-13-7-9-15(21-13)22(19,20)18-14-8-6-12(10-17-14)11-4-2-1-3-5-11/h1-10H,(H,17,18) |
| InChIKey | TZXUQADGCCMELY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |