C13H14ClN3O3S2 — CID 113025338
5-chloro-N-(5-morpholin-4-yl-2-pyridinyl)thiophene-2-sulfonamide (PubChem CID 113025338) has the molecular formula C13H14ClN3O3S2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 5-chloro-N-(5-morpholin-4-yl-2-pyridinyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(5-morpholin-4-yl-2-pyridinyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113025338 |
| Molecular Formula | C13H14ClN3O3S2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 5-chloro-N-(5-morpholin-4-yl-2-pyridinyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(N2CCOCC2)cn1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H14ClN3O3S2/c14-11-2-4-13(21-11)22(18,19)16-12-3-1-10(9-15-12)17-5-7-20-8-6-17/h1-4,9H,5-8H2,(H,15,16) |
| InChIKey | ZTACXHKMNLLSPU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |