C16H20ClN3O2S2 — CID 113030748
5-chloro-N-[5-(2-ethylpiperidin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113030748) has the molecular formula C16H20ClN3O2S2 and a molecular weight of 385.94 g/mol. Its IUPAC name is 5-chloro-N-[5-(2-ethylpiperidin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[5-(2-ethylpiperidin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113030748 |
| Molecular Formula | C16H20ClN3O2S2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 5-chloro-N-[5-(2-ethylpiperidin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide |
| SMILES | CCC1CCCCN1c1ccc(NS(=O)(=O)c2ccc(Cl)s2)nc1 |
| InChI | InChI=1S/C16H20ClN3O2S2/c1-2-12-5-3-4-10-20(12)13-6-8-15(18-11-13)19-24(21,22)16-9-7-14(17)23-16/h6-9,11-12H,2-5,10H2,1H3,(H,18,19) |
| InChIKey | PKZOUAJQQXYCGO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |