C15H19ClN4O2S2 — CID 113026023
5-chloro-N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113026023) has the molecular formula C15H19ClN4O2S2 and a molecular weight of 386.93 g/mol. Its IUPAC name is 5-chloro-N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113026023 |
| Molecular Formula | C15H19ClN4O2S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 5-chloro-N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide |
| SMILES | CCN1CCN(c2ccc(NS(=O)(=O)c3ccc(Cl)s3)nc2)CC1 |
| InChI | InChI=1S/C15H19ClN4O2S2/c1-2-19-7-9-20(10-8-19)12-3-5-14(17-11-12)18-24(21,22)15-6-4-13(16)23-15/h3-6,11H,2,7-10H2,1H3,(H,17,18) |
| InChIKey | RQUILBPIMHPCOW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |