C16H20N4O4S2 — CID 113029334
ethyl 4-[6-(thiophen-2-ylsulfonylamino)-3-pyridinyl]piperazine-1-carboxylate (PubChem CID 113029334) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl 4-[6-(thiophen-2-ylsulfonylamino)-3-pyridinyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(thiophen-2-ylsulfonylamino)-3-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 113029334 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | ethyl 4-[6-(thiophen-2-ylsulfonylamino)-3-pyridinyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccc(NS(=O)(=O)c3cccs3)nc2)CC1 |
| InChI | InChI=1S/C16H20N4O4S2/c1-2-24-16(21)20-9-7-19(8-10-20)13-5-6-14(17-12-13)18-26(22,23)15-4-3-11-25-15/h3-6,11-12H,2,7-10H2,1H3,(H,17,18) |
| InChIKey | POYIEXCEWIRQLT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |