C22H29N5O5S2 — CID 46333344
ethyl 4-[4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzoyl]piperazine-1-carboxylate (PubChem CID 46333344) has the molecular formula C22H29N5O5S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is ethyl 4-[4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46333344 |
| Molecular Formula | C22H29N5O5S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | ethyl 4-[4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(N3CCNCC3)c(NS(=O)(=O)c3cccs3)c2)CC1 |
| InChI | InChI=1S/C22H29N5O5S2/c1-2-32-22(29)27-13-11-26(12-14-27)21(28)17-5-6-19(25-9-7-23-8-10-25)18(16-17)24-34(30,31)20-4-3-15-33-20/h3-6,15-16,23-24H,2,7-14H2,1H3 |
| InChIKey | HLGSNDUBDVPXBF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |