C17H22N4O3S2 — CID 46333696
N-ethyl-4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 46333696) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-ethyl-4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-ethyl-4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 46333696 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-ethyl-4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CCNC(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H22N4O3S2/c1-2-19-17(22)13-5-6-15(21-9-7-18-8-10-21)14(12-13)20-26(23,24)16-4-3-11-25-16/h3-6,11-12,18,20H,2,7-10H2,1H3,(H,19,22) |
| InChIKey | KCJLHUOHLOCECW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |