C22H23ClN4O3S2 — CID 46333657
N-[(2-chlorophenyl)methyl]-4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 46333657) has the molecular formula C22H23ClN4O3S2 and a molecular weight of 491.04 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 46333657 |
| Molecular Formula | C22H23ClN4O3S2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-piperazin-1-yl-3-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NCc1ccccc1Cl)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C22H23ClN4O3S2/c23-18-5-2-1-4-17(18)15-25-22(28)16-7-8-20(27-11-9-24-10-12-27)19(14-16)26-32(29,30)21-6-3-13-31-21/h1-8,13-14,24,26H,9-12,15H2,(H,25,28) |
| InChIKey | POYXAISMUBJQJC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |