C20H25FN4O4S — CID 46333677
3-[(2-fluorophenyl)sulfonylamino]-N-(2-methoxyethyl)-4-piperazin-1-ylbenzamide (PubChem CID 46333677) has the molecular formula C20H25FN4O4S and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfonylamino]-N-(2-methoxyethyl)-4-piperazin-1-ylbenzamide.
| Compound Name | 3-[(2-fluorophenyl)sulfonylamino]-N-(2-methoxyethyl)-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46333677 |
| Molecular Formula | C20H25FN4O4S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfonylamino]-N-(2-methoxyethyl)-4-piperazin-1-ylbenzamide |
| SMILES | COCCNC(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C20H25FN4O4S/c1-29-13-10-23-20(26)15-6-7-18(25-11-8-22-9-12-25)17(14-15)24-30(27,28)19-5-3-2-4-16(19)21/h2-7,14,22,24H,8-13H2,1H3,(H,23,26) |
| InChIKey | CNVIRNNBPXNMAE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|