C25H35N5O5S — CID 46333368
3-[(2,4-dimethylphenyl)sulfonylamino]-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N-methyl-4-piperazin-1-ylbenzamide (PubChem CID 46333368) has the molecular formula C25H35N5O5S and a molecular weight of 517.65 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)sulfonylamino]-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N-methyl-4-piperazin-1-ylbenzamide.
| Compound Name | 3-[(2,4-dimethylphenyl)sulfonylamino]-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N-methyl-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46333368 |
| Molecular Formula | C25H35N5O5S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)sulfonylamino]-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N-methyl-4-piperazin-1-ylbenzamide |
| SMILES | COCCNC(=O)CN(C)C(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C25H35N5O5S/c1-18-5-8-23(19(2)15-18)36(33,34)28-21-16-20(6-7-22(21)30-12-9-26-10-13-30)25(32)29(3)17-24(31)27-11-14-35-4/h5-8,15-16,26,28H,9-14,17H2,1-4H3,(H,27,31) |
| InChIKey | SIHWHDAAFAHHQQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|