C22H26F4N4O6S — CID 146059374
3-[(2-fluorophenyl)sulfonylamino]-N-(2-methoxyethyl)-4-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 146059374) has the molecular formula C22H26F4N4O6S and a molecular weight of 550.53 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfonylamino]-N-(2-methoxyethyl)-4-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(2-fluorophenyl)sulfonylamino]-N-(2-methoxyethyl)-4-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146059374 |
| Molecular Formula | C22H26F4N4O6S |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfonylamino]-N-(2-methoxyethyl)-4-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2ccccc2F)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H25FN4O4S.C2HF3O2/c1-29-13-10-23-20(26)15-6-7-18(25-11-8-22-9-12-25)17(14-15)24-30(27,28)19-5-3-2-4-16(19)21;3-2(4,5)1(6)7/h2-7,14,22,24H,8-13H2,1H3,(H,23,26);(H,6,7) |
| InChIKey | LNOZSTBOHAQTQC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|