C26H31F3N4O5S — CID 146059146
3-[(2-methylphenyl)sulfonylamino]-4-piperazin-1-yl-N,N-bis(prop-2-enyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 146059146) has the molecular formula C26H31F3N4O5S and a molecular weight of 568.62 g/mol. Its IUPAC name is 3-[(2-methylphenyl)sulfonylamino]-4-piperazin-1-yl-N,N-bis(prop-2-enyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(2-methylphenyl)sulfonylamino]-4-piperazin-1-yl-N,N-bis(prop-2-enyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146059146 |
| Molecular Formula | C26H31F3N4O5S |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 3-[(2-methylphenyl)sulfonylamino]-4-piperazin-1-yl-N,N-bis(prop-2-enyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2ccccc2C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H30N4O3S.C2HF3O2/c1-4-14-28(15-5-2)24(29)20-10-11-22(27-16-12-25-13-17-27)21(18-20)26-32(30,31)23-9-7-6-8-19(23)3;3-2(4,5)1(6)7/h4-11,18,25-26H,1-2,12-17H2,3H3;(H,6,7) |
| InChIKey | PRLWBPFWAYAEOE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|