C28H34F3N5O6S — CID 146059178
3-[(2-acetamido-5-methylphenyl)sulfonylamino]-4-piperazin-1-yl-N,N-bis(prop-2-enyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 146059178) has the molecular formula C28H34F3N5O6S and a molecular weight of 625.67 g/mol. Its IUPAC name is 3-[(2-acetamido-5-methylphenyl)sulfonylamino]-4-piperazin-1-yl-N,N-bis(prop-2-enyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(2-acetamido-5-methylphenyl)sulfonylamino]-4-piperazin-1-yl-N,N-bis(prop-2-enyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146059178 |
| Molecular Formula | C28H34F3N5O6S |
| Molecular Weight | 625.67 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | 3-[(2-acetamido-5-methylphenyl)sulfonylamino]-4-piperazin-1-yl-N,N-bis(prop-2-enyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2cc(C)ccc2NC(C)=O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H33N5O4S.C2HF3O2/c1-5-13-31(14-6-2)26(33)21-8-10-24(30-15-11-27-12-16-30)23(18-21)29-36(34,35)25-17-19(3)7-9-22(25)28-20(4)32;3-2(4,5)1(6)7/h5-10,17-18,27,29H,1-2,11-16H2,3-4H3,(H,28,32);(H,6,7) |
| InChIKey | HYSKUWMQMSANGN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|