C26H37N5O4S — CID 46333477
3-[(2-acetamido-5-methylphenyl)sulfonylamino]-N-butyl-N-ethyl-4-piperazin-1-ylbenzamide (PubChem CID 46333477) has the molecular formula C26H37N5O4S and a molecular weight of 515.68 g/mol. Its IUPAC name is 3-[(2-acetamido-5-methylphenyl)sulfonylamino]-N-butyl-N-ethyl-4-piperazin-1-ylbenzamide.
| Compound Name | 3-[(2-acetamido-5-methylphenyl)sulfonylamino]-N-butyl-N-ethyl-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46333477 |
| Molecular Formula | C26H37N5O4S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 3-[(2-acetamido-5-methylphenyl)sulfonylamino]-N-butyl-N-ethyl-4-piperazin-1-ylbenzamide |
| SMILES | CCCCN(CC)C(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2cc(C)ccc2NC(C)=O)c1 |
| InChI | InChI=1S/C26H37N5O4S/c1-5-7-14-30(6-2)26(33)21-9-11-24(31-15-12-27-13-16-31)23(18-21)29-36(34,35)25-17-19(3)8-10-22(25)28-20(4)32/h8-11,17-18,27,29H,5-7,12-16H2,1-4H3,(H,28,32) |
| InChIKey | UYYFDQFLOLPYAP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |