C19H22ClFN4O3S — CID 46333711
3-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-ethyl-4-piperazin-1-ylbenzamide (PubChem CID 46333711) has the molecular formula C19H22ClFN4O3S and a molecular weight of 440.93 g/mol. Its IUPAC name is 3-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-ethyl-4-piperazin-1-ylbenzamide.
| Compound Name | 3-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-ethyl-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46333711 |
| Molecular Formula | C19H22ClFN4O3S |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 3-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-ethyl-4-piperazin-1-ylbenzamide |
| SMILES | CCNC(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H22ClFN4O3S/c1-2-23-19(26)13-3-6-18(25-9-7-22-8-10-25)17(11-13)24-29(27,28)14-4-5-16(21)15(20)12-14/h3-6,11-12,22,24H,2,7-10H2,1H3,(H,23,26) |
| InChIKey | JAQKBSXFIAVITC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |