C23H24ClN5O3S — CID 46333589
3-[(4-chlorophenyl)sulfonylamino]-4-piperazin-1-yl-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 46333589) has the molecular formula C23H24ClN5O3S and a molecular weight of 486.00 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-4-piperazin-1-yl-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-4-piperazin-1-yl-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46333589 |
| Molecular Formula | C23H24ClN5O3S |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-4-piperazin-1-yl-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccncc1)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H24ClN5O3S/c24-19-2-4-20(5-3-19)33(31,32)28-21-15-18(1-6-22(21)29-13-11-26-12-14-29)23(30)27-16-17-7-9-25-10-8-17/h1-10,15,26,28H,11-14,16H2,(H,27,30) |
| InChIKey | HBRPLGZHDQWHAE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |