C26H36N4O3S — CID 46333723
3-[(4-cyclohexylphenyl)sulfonylamino]-4-piperazin-1-yl-N-propylbenzamide (PubChem CID 46333723) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is 3-[(4-cyclohexylphenyl)sulfonylamino]-4-piperazin-1-yl-N-propylbenzamide.
| Compound Name | 3-[(4-cyclohexylphenyl)sulfonylamino]-4-piperazin-1-yl-N-propylbenzamide |
|---|---|
| PubChem CID | 46333723 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 3-[(4-cyclohexylphenyl)sulfonylamino]-4-piperazin-1-yl-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2ccc(C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C26H36N4O3S/c1-2-14-28-26(31)22-10-13-25(30-17-15-27-16-18-30)24(19-22)29-34(32,33)23-11-8-21(9-12-23)20-6-4-3-5-7-20/h8-13,19-20,27,29H,2-7,14-18H2,1H3,(H,28,31) |
| InChIKey | SZGCUHXUIFAENU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |