C24H32N4O3S — CID 46333755
N-cyclopentyl-3-[(4-ethylphenyl)sulfonylamino]-4-piperazin-1-ylbenzamide (PubChem CID 46333755) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is N-cyclopentyl-3-[(4-ethylphenyl)sulfonylamino]-4-piperazin-1-ylbenzamide.
| Compound Name | N-cyclopentyl-3-[(4-ethylphenyl)sulfonylamino]-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46333755 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-cyclopentyl-3-[(4-ethylphenyl)sulfonylamino]-4-piperazin-1-ylbenzamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc(C(=O)NC3CCCC3)ccc2N2CCNCC2)cc1 |
| InChI | InChI=1S/C24H32N4O3S/c1-2-18-7-10-21(11-8-18)32(30,31)27-22-17-19(24(29)26-20-5-3-4-6-20)9-12-23(22)28-15-13-25-14-16-28/h7-12,17,20,25,27H,2-6,13-16H2,1H3,(H,26,29) |
| InChIKey | ORJGTFPKQOPDDQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |